Hyaluronic acid
Moisturizing Properties: Hyaluronic acid demonstrates remarkable capacity to bind and retain water molecules, establishing itself as nature's most efficient hydrating agent for skin and connective tissues.
Joint Lubrication: This biopolymer serves as a vital component in synovial fluid, where it minimizes mechanical friction between articular surfaces and supports joint functionality.
Wound Healing: In medical applications, hyaluronic acid accelerates tissue repair processes by creating optimal hydration environments that facilitate cellular migration and modulate inflammatory responses.
Vessel Permeability Regulation: The acid contributes to vascular homeostasis by dynamically modulating endothelial permeability, thereby optimizing the exchange of plasma proteins and nutrients within biological systems.
Hyaluronic acid is an acidic glycosaminoglycan characterized by a distinctive molecular configuration that confers exceptional physicochemical properties. It performs essential biological functions including contributing to joint lubrication, modulating vascular wall permeability, directing the transport and activity of proteins and their hydrolysates, and facilitating wound regeneration processes.
This biomolecule demonstrates unparalleled hygroscopic capacity, establishing it as the most effective natural humectant identified in biological systems. These properties validate its recognition as an optimal natural moisturizing component, delivering hydrative benefits to both cutaneous tissues and internal organ systems.
Parameters
storage temp. | −20°C |
solubility | H2O: 5 mg/mL, clear, colorless |
form | Lyophilized Powder |
color | White |
Odor | Odorless |
optical activity | -70～-80 |
Water Solubility | Soluble in water. |
InChIKey | MAKUBRYLFHZREJ-IUPJJCKZNA-M |
SMILES | [C@@H]1(O[C@H]2[C@H](O)[C@H]([C@H](O)O[C@@H]2C(=O)[O-])O)O[C@H](CO)[C@@H](O)C[C@H]1NC(=O)C.[Na+] |&1:0,2,3,5,6,9,15,18,21,r| |
LogP | -6.623 (est) |
CAS DataBase Reference | 9004-61-9 |
EPA Substance Registry System | Hyaluronic acid (9004-61-9) |
Safety Information | |
Hazard Codes | B |
Safety Statements | 22-24/25 |
WGK Germany | 3 |
RTECS | MT7250000 |
F | 45726 |
TSCA | Yes |
Hazardous Substances Data | 9004-61-9(Hazardous Substances Data) |
