Potassium heptadecafluoro-1-octanesulfonate
Superior Chemical Stability: Potassium perfluorooctanesulfonate (PFOS-K) is highly valued for its exceptional chemical stability, making it perfect for demanding industrial applications.
Efficient Chromium Mist Control: In electroplating, PFOS-K plays a vital role in minimizing toxic chromium mist emissions by creating stable foam layers.
Effective Wetting Agent: As a powerful surface-active agent, PFOS-K is widely used in fluoroprotein firefighting foams, significantly improving fire suppression performance.
Water and Oil Repellent: Its unique molecular structure grants strong hydrophobic and oleophobic properties, ensuring effective resistance to both water and oil in various applications.
Potassium perfluorooctanesulfonate (PFOS-K, CAS 2795-39-3) is an organofluorine surfactant renowned for its exceptional chemical stability and surface-active properties, making it indispensable in various industrial applications. As the potassium salt of perfluorooctanesulfonic acid (PFOS), PFOS-K is essential in electroplating for controlling chromium mist, where it forms stable foam layers that significantly reduce toxic acid mist emissions. In addition to its role in electroplating, PFOS-K serves as a wetting agent and is commonly used as an additive in fluoroprotein-type firefighting foams. Its unique molecular structure, featuring a fully fluorinated 8-carbon chain and a sulfonate group, provides strong hydrophobic and oleophobic characteristics. However, due to its persistence in the environment and potential bioaccumulation, PFOS-K is regulated under the Stockholm Convention on Persistent Organic Pollutants. Its use is now restricted to specific industrial processes where alternatives are not feasible. For safe handling, PFOS-K should be stored in sealed containers (typically 25kg drums) and kept at temperatures below 300°C to avoid the formation of harmful byproducts.
Parameters
Melting point | 277-280 °C(lit.) |
density | 1.1 |
solubility | Methanol, Water (Slightly, Heated, Sonicated) |
form | |
color | white |
BRN | 3864579 |
Stability: | Hygroscopic |
InChI | InChI=1S/C8HF17O3S.K/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28;/h(H,26,27,28);/q;+1/p-1 |
InChIKey | WFRUBUQWJYMMRQ-UHFFFAOYSA-M |
SMILES | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)S([O-])(=O)=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
CAS DataBase Reference | 2795-39-3(CAS DataBase Reference) |
EPA Substance Registry System | Potassium perfluorooctanesulfonate (2795-39-3) |
Safety Information
Hazard Codes | Xn,N,C,Xi,T |
Risk Statements | 20/22-36/37/38-51/53-22-57-64-48/25-40-61 |
Safety Statements | 26-61-45-53 |
RIDADR | UN 2811 6.1/PG 3 |
WGK Germany | 3 |
RTECS | RG9701850 |
Hazard Note | Corrosive |
TSCA | Yes |
HazardClass | 6.1 |
HazardClass | IRRITANT |
HS Code | 29049090 |
Potassium perfluorooctanesulfonate (PFOS-K, CAS 2795-39-3) is a fluorinated surfactant valued in industrial applications for its high chemical stability and effective surface activity. As the potassium salt of perfluorooctanesulfonic acid, it is particularly important in electroplating for chromium mist suppression, where it forms durable foam layers that minimize the release of toxic acid mists. It also functions as a wetting agent and is used as a key ingredient in fluoroprotein fire-fighting foams. The molecule features a perfluorinated carbon chain and a sulfonate group, giving it both hydrophobic and oleophobic properties.
