Ethylenediaminetetraacetic acid CAS No.：60-00-4
Ethylenediaminetetraacetic acid (EDTA) is an organic compound with the chemical formula C10H16N2O8. At room temperature and normal pressure, it exists as a white powder. It is a chelating agent that can combine with divalent metal ions such as Mg2+, Ca2+, Mn2+, and Fe2+. Since most nucleases and some proteases require Mg2+ for their functions, it is commonly used as an inhibitor for nucleases and proteases; it can also be used to remove the inhibitory effect of heavy metal ions on enzymes.
<b(Ethylenediaminetetraacetic acid) is the acidic form of edetate and is a chelating agent with the properties of preventing hypercalcemia and anticoagulation. Bis(ethylenediaminetetraacetic acid) can combine with calcium ions and heavy metal ions to form soluble and stable complexes. It is also used as an anticoagulant for blood samples and is employed in the treatment of lead poisoning.
| Density | 1.6±0.1 g/cm3 |
| Boiling point | 614.2±55.0 °C at 760 mmHg |
| Melting point | 250 °C (dec.)(lit.) |
| Molecular formula | C10H16N2O8 |
| Molecular weight | 292.243 |
| Flash point | 325.2±31.5 °C |
| Precise mass | 292.090668 |
| PSA | 155.68 |
| LogP | -0.43 |
| InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Appearance characteristics | White crystals or powder |
| Steam pressure | 0.0±3.8 mmHg at 25°C |
| Refractive index | 1.58 |
| Storage conditions | 1. Store in a cool and dry place. 2. Do not mix with alkaline chemicals. |
| Stability | 1. The solubility in water is 0.5g/L (at 25℃). A decarboxylation reaction will occur when heated to 150℃. 2. It should be avoided from being ingested, inhaled or coming into contact with the skin or eyes. 3. It can form stable complexes with various metal ions and is commonly used as a complexing agent in electroplating and chemical plating. |
| Water solubility | 0.5 g/L (25 ºC) |
| Molecular structure | 1. Molecular refractive index: 62.07 2. Molar volume (cm³/mol): 186.6 3. Isothermal volume (90.2K): 568.5 4. Surface tension (dyne/cm): 86.1 5. Polarizability (10⁻²⁴ cm³): 24.60 |
Operation, Disposal and Storage
1. Precautions for safe operation
Avoid contact with skin and eyes. Avoid the formation of dust and aerosols.
Provide appropriate ventilation equipment in areas where dust is generated.
2. Conditions for safe storage, including any incompatibilities
Store in a cool place. Keep the containers sealed and store in a dry and well-ventilated area.
Application：
EDTA is an important complexing agent. EDTA has a wide range of applications. It can be used as a bleaching and fixing solution for color photographic materials during processing, a dyeing aid, a fiber treatment aid, a cosmetic additive, a blood anticoagulant, a detergent, a stabilizer, a polymerization initiator for synthetic rubber, and is a representative substance of chelating agents. It can form stable water-soluble complexes with alkaline earth metals, rare earth elements, and transition metals, etc. Apart from sodium salts, it also contains ammonium salts and various salts such as iron, magnesium, calcium, copper, manganese, zinc, cobalt, and aluminum. Each of these salts has different applications. In addition, EDTA can also be used to rapidly excrete harmful radioactive metals from the human body, achieving detoxification effects. It is also a water treatment agent. EDTA is also an important indicator, and can be used for titration of metals such as nickel and copper. When using it, it should be combined with ammonia water to function as an indicator.
